C16H26N6O5 — CID 118183250
(2S)-5-(carbamoylamino)-2-[4-[(1S)-2-methyl-1-(prop-2-enoxycarbonylamino)propyl]triazol-1-yl]pentanoic acid (PubChem CID 118183250) has the molecular formula C16H26N6O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is (2S)-5-(carbamoylamino)-2-[4-[(1S)-2-methyl-1-(prop-2-enoxycarbonylamino)propyl]triazol-1-yl]pentanoic acid.
| Compound Name | (2S)-5-(carbamoylamino)-2-[4-[(1S)-2-methyl-1-(prop-2-enoxycarbonylamino)propyl]triazol-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 118183250 |
| Molecular Formula | C16H26N6O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | (2S)-5-(carbamoylamino)-2-[4-[(1S)-2-methyl-1-(prop-2-enoxycarbonylamino)propyl]triazol-1-yl]pentanoic acid |
| SMILES | C=CCOC(=O)N[C@H](c1cn([C@@H](CCCNC(N)=O)C(=O)O)nn1)C(C)C |
| InChI | InChI=1S/C16H26N6O5/c1-4-8-27-16(26)19-13(10(2)3)11-9-22(21-20-11)12(14(23)24)6-5-7-18-15(17)25/h4,9-10,12-13H,1,5-8H2,2-3H3,(H,19,26)(H,23,24)(H3,17,18,25)/t12-,13-/m0/s1 |
| InChIKey | RTIYQOZMTURSDU-STQMWFEESA-N |
| XLogP | 0.96 |
| TPSA | 161.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|