C15H26N6O4 — CID 138483297
methyl (2S)-2-[4-[(1S)-1-acetamido-2-methylpropyl]triazol-1-yl]-5-(carbamoylamino)pentanoate (PubChem CID 138483297) has the molecular formula C15H26N6O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is methyl (2S)-2-[4-[(1S)-1-acetamido-2-methylpropyl]triazol-1-yl]-5-(carbamoylamino)pentanoate.
| Compound Name | methyl (2S)-2-[4-[(1S)-1-acetamido-2-methylpropyl]triazol-1-yl]-5-(carbamoylamino)pentanoate |
|---|---|
| PubChem CID | 138483297 |
| Molecular Formula | C15H26N6O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | methyl (2S)-2-[4-[(1S)-1-acetamido-2-methylpropyl]triazol-1-yl]-5-(carbamoylamino)pentanoate |
| SMILES | COC(=O)[C@H](CCCNC(N)=O)n1cc([C@@H](NC(C)=O)C(C)C)nn1 |
| InChI | InChI=1S/C15H26N6O4/c1-9(2)13(18-10(3)22)11-8-21(20-19-11)12(14(23)25-4)6-5-7-17-15(16)24/h8-9,12-13H,5-7H2,1-4H3,(H,18,22)(H3,16,17,24)/t12-,13-/m0/s1 |
| InChIKey | FECANPHRINVLPC-STQMWFEESA-N |
| XLogP | 0.27 |
| TPSA | 141.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|