C19H28N6O3 — CID 122577512
(2S)-2-(4-tert-butyltriazol-1-yl)-5-(carbamoylamino)-N-[4-(hydroxymethyl)phenyl]pentanamide (PubChem CID 122577512) has the molecular formula C19H28N6O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is (2S)-2-(4-tert-butyltriazol-1-yl)-5-(carbamoylamino)-N-[4-(hydroxymethyl)phenyl]pentanamide.
| Compound Name | (2S)-2-(4-tert-butyltriazol-1-yl)-5-(carbamoylamino)-N-[4-(hydroxymethyl)phenyl]pentanamide |
|---|---|
| PubChem CID | 122577512 |
| Molecular Formula | C19H28N6O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | (2S)-2-(4-tert-butyltriazol-1-yl)-5-(carbamoylamino)-N-[4-(hydroxymethyl)phenyl]pentanamide |
| SMILES | CC(C)(C)c1cn([C@@H](CCCNC(N)=O)C(=O)Nc2ccc(CO)cc2)nn1 |
| InChI | InChI=1S/C19H28N6O3/c1-19(2,3)16-11-25(24-23-16)15(5-4-10-21-18(20)28)17(27)22-14-8-6-13(12-26)7-9-14/h6-9,11,15,26H,4-5,10,12H2,1-3H3,(H,22,27)(H3,20,21,28)/t15-/m0/s1 |
| InChIKey | CLLPZRFRAPLTPZ-HNNXBMFYSA-N |
| XLogP | 1.70 |
| TPSA | 135.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|