C27H34N6O4 — CID 155204366
(2S)-5-(carbamoylamino)-N-[4-(hydroxymethyl)phenyl]-2-[[(2S)-3-methyl-2-(quinolin-2-ylamino)butanoyl]amino]pentanamide (PubChem CID 155204366) has the molecular formula C27H34N6O4 and a molecular weight of 506.61 g/mol. Its IUPAC name is (2S)-5-(carbamoylamino)-N-[4-(hydroxymethyl)phenyl]-2-[[(2S)-3-methyl-2-(quinolin-2-ylamino)butanoyl]amino]pentanamide.
| Compound Name | (2S)-5-(carbamoylamino)-N-[4-(hydroxymethyl)phenyl]-2-[[(2S)-3-methyl-2-(quinolin-2-ylamino)butanoyl]amino]pentanamide |
|---|---|
| PubChem CID | 155204366 |
| Molecular Formula | C27H34N6O4 |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.26 |
| IUPAC Name | (2S)-5-(carbamoylamino)-N-[4-(hydroxymethyl)phenyl]-2-[[(2S)-3-methyl-2-(quinolin-2-ylamino)butanoyl]amino]pentanamide |
| SMILES | CC(C)[C@H](Nc1ccc2ccccc2n1)C(=O)N[C@@H](CCCNC(N)=O)C(=O)Nc1ccc(CO)cc1 |
| InChI | InChI=1S/C27H34N6O4/c1-17(2)24(33-23-14-11-19-6-3-4-7-21(19)31-23)26(36)32-22(8-5-15-29-27(28)37)25(35)30-20-12-9-18(16-34)10-13-20/h3-4,6-7,9-14,17,22,24,34H,5,8,15-16H2,1-2H3,(H,30,35)(H,31,33)(H,32,36)(H3,28,29,37)/t22-,24-/m0/s1 |
| InChIKey | RZQAHIPXMPYUTI-UPVQGACJSA-N |
| XLogP | 2.74 |
| TPSA | 158.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|