C36H41N5O9 — CID 160608121
[4-[(3S)-6-(carbamoylamino)-3-[[(2S)-5-[3-(4-isocyanophenoxy)-2,5-dioxopyrrol-1-yl]-4-oxo-2-propan-2-ylpentanoyl]amino]-2-oxohexyl]phenyl]methyl 2-tritiopropanoate (PubChem CID 160608121) has the molecular formula C36H41N5O9 and a molecular weight of 689.76 g/mol. Its IUPAC name is [4-[(3S)-6-(carbamoylamino)-3-[[(2S)-5-[3-(4-isocyanophenoxy)-2,5-dioxopyrrol-1-yl]-4-oxo-2-propan-2-ylpentanoyl]amino]-2-oxohexyl]phenyl]methyl 2-tritiopropanoate.
| Compound Name | [4-[(3S)-6-(carbamoylamino)-3-[[(2S)-5-[3-(4-isocyanophenoxy)-2,5-dioxopyrrol-1-yl]-4-oxo-2-propan-2-ylpentanoyl]amino]-2-oxohexyl]phenyl]methyl 2-tritiopropanoate |
|---|---|
| PubChem CID | 160608121 |
| Molecular Formula | C36H41N5O9 |
| Molecular Weight | 689.76 g/mol |
| Exact Mass | 689.30 |
| IUPAC Name | [4-[(3S)-6-(carbamoylamino)-3-[[(2S)-5-[3-(4-isocyanophenoxy)-2,5-dioxopyrrol-1-yl]-4-oxo-2-propan-2-ylpentanoyl]amino]-2-oxohexyl]phenyl]methyl 2-tritiopropanoate |
| SMILES | [3H]C(C)C(=O)OCc1ccc(CC(=O)[C@H](CCCNC(N)=O)NC(=O)[C@@H](CC(=O)CN2C(=O)C=C(Oc3ccc([N+]#[C-])cc3)C2=O)C(C)C)cc1 |
| InChI | InChI=1S/C36H41N5O9/c1-5-33(45)49-21-24-10-8-23(9-11-24)17-30(43)29(7-6-16-39-36(37)48)40-34(46)28(22(2)3)18-26(42)20-41-32(44)19-31(35(41)47)50-27-14-12-25(38-4)13-15-27/h8-15,19,22,28-29H,5-7,16-18,20-21H2,1-3H3,(H,40,46)(H3,37,39,48)/t28-,29-/m0/s1/i5T/t5?,28-,29- |
| InChIKey | RFDNBYBTNLNVQQ-XBFVLDASSA-N |
| XLogP | 3.30 |
| TPSA | 195.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.76 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|