C27H39BN2O4 — CID 175909307
6-(dimethylamino)-N-[4-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]methyl]phenyl]hexanamide (PubChem CID 175909307) has the molecular formula C27H39BN2O4 and a molecular weight of 466.43 g/mol. Its IUPAC name is 6-(dimethylamino)-N-[4-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]methyl]phenyl]hexanamide.
| Compound Name | 6-(dimethylamino)-N-[4-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]methyl]phenyl]hexanamide |
|---|---|
| PubChem CID | 175909307 |
| Molecular Formula | C27H39BN2O4 |
| Molecular Weight | 466.43 g/mol |
| Exact Mass | 466.30 |
| IUPAC Name | 6-(dimethylamino)-N-[4-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]methyl]phenyl]hexanamide |
| SMILES | CN(C)CCCCCC(=O)Nc1ccc(COc2ccccc2B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C27H39BN2O4/c1-26(2)27(3,4)34-28(33-26)23-12-9-10-13-24(23)32-20-21-15-17-22(18-16-21)29-25(31)14-8-7-11-19-30(5)6/h9-10,12-13,15-18H,7-8,11,14,19-20H2,1-6H3,(H,29,31) |
| InChIKey | XADDYSVZHKHMPI-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.43 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|