C32H43LaN6O4- — CID 162683121
N-[6-(dimethylamino)-1-oxo-1-[4-[[2-[(1Z)-1,4,4-triamino-3-methylbuta-1,3-dienyl]phenoxy]methyl]anilino]hexan-2-yl]-1-(oxomethyl)cyclobutane-1-carboxamide;lanthanum (PubChem CID 162683121) has the molecular formula C32H43LaN6O4- and a molecular weight of 714.64 g/mol. Its IUPAC name is N-[6-(dimethylamino)-1-oxo-1-[4-[[2-[(1Z)-1,4,4-triamino-3-methylbuta-1,3-dienyl]phenoxy]methyl]anilino]hexan-2-yl]-1-(oxomethyl)cyclobutane-1-carboxamide;lanthanum.
| Compound Name | N-[6-(dimethylamino)-1-oxo-1-[4-[[2-[(1Z)-1,4,4-triamino-3-methylbuta-1,3-dienyl]phenoxy]methyl]anilino]hexan-2-yl]-1-(oxomethyl)cyclobutane-1-carboxamide;lanthanum |
|---|---|
| PubChem CID | 162683121 |
| Molecular Formula | C32H43LaN6O4- |
| Molecular Weight | 714.64 g/mol |
| Exact Mass | 714.24 |
| IUPAC Name | N-[6-(dimethylamino)-1-oxo-1-[4-[[2-[(1Z)-1,4,4-triamino-3-methylbuta-1,3-dienyl]phenoxy]methyl]anilino]hexan-2-yl]-1-(oxomethyl)cyclobutane-1-carboxamide;lanthanum |
| SMILES | CC(/C=C(\N)c1ccccc1OCc1ccc(NC(=O)C(CCCCN(C)C)NC(=O)C2([C-]=O)CCC2)cc1)=C(N)N.[La] |
| InChI | InChI=1S/C32H43N6O4.La/c1-22(29(34)35)19-26(33)25-9-4-5-11-28(25)42-20-23-12-14-24(15-13-23)36-30(40)27(10-6-7-18-38(2)3)37-31(41)32(21-39)16-8-17-32;/h4-5,9,11-15,19,27H,6-8,10,16-18,20,33-35H2,1-3H3,(H,36,40)(H,37,41);/q-1;/b26-19-; |
| InChIKey | UVXXBTXVGUCRHS-XDUZALLESA-N |
| XLogP | 3.15 |
| TPSA | 165.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.64 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|