C26H36BrN3O4 — CID 170068923
tert-butyl N-[1-[4-[(2-bromophenoxy)methyl]anilino]-6-(dimethylamino)-1-oxohexan-2-yl]carbamate (PubChem CID 170068923) has the molecular formula C26H36BrN3O4 and a molecular weight of 534.50 g/mol. Its IUPAC name is tert-butyl N-[1-[4-[(2-bromophenoxy)methyl]anilino]-6-(dimethylamino)-1-oxohexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[4-[(2-bromophenoxy)methyl]anilino]-6-(dimethylamino)-1-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 170068923 |
| Molecular Formula | C26H36BrN3O4 |
| Molecular Weight | 534.50 g/mol |
| Exact Mass | 533.19 |
| IUPAC Name | tert-butyl N-[1-[4-[(2-bromophenoxy)methyl]anilino]-6-(dimethylamino)-1-oxohexan-2-yl]carbamate |
| SMILES | CN(C)CCCCC(NC(=O)OC(C)(C)C)C(=O)Nc1ccc(COc2ccccc2Br)cc1 |
| InChI | InChI=1S/C26H36BrN3O4/c1-26(2,3)34-25(32)29-22(11-8-9-17-30(4)5)24(31)28-20-15-13-19(14-16-20)18-33-23-12-7-6-10-21(23)27/h6-7,10,12-16,22H,8-9,11,17-18H2,1-5H3,(H,28,31)(H,29,32) |
| InChIKey | KQNCBVQLHKPBBZ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.50 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|