C21H25IN2O5 — CID 143188420
tert-butyl N-[(2S)-3-hydroxy-1-[4-[(4-iodophenyl)methoxy]anilino]-1-oxopropan-2-yl]carbamate (PubChem CID 143188420) has the molecular formula C21H25IN2O5 and a molecular weight of 512.34 g/mol. Its IUPAC name is tert-butyl N-[(2S)-3-hydroxy-1-[4-[(4-iodophenyl)methoxy]anilino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-3-hydroxy-1-[4-[(4-iodophenyl)methoxy]anilino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 143188420 |
| Molecular Formula | C21H25IN2O5 |
| Molecular Weight | 512.34 g/mol |
| Exact Mass | 512.08 |
| IUPAC Name | tert-butyl N-[(2S)-3-hydroxy-1-[4-[(4-iodophenyl)methoxy]anilino]-1-oxopropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CO)C(=O)Nc1ccc(OCc2ccc(I)cc2)cc1 |
| InChI | InChI=1S/C21H25IN2O5/c1-21(2,3)29-20(27)24-18(12-25)19(26)23-16-8-10-17(11-9-16)28-13-14-4-6-15(22)7-5-14/h4-11,18,25H,12-13H2,1-3H3,(H,23,26)(H,24,27)/t18-/m0/s1 |
| InChIKey | FVPYZAJGGYEJDY-SFHVURJKSA-N |
| XLogP | 3.69 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|