C24H35ClN4O6 — CID 164924620
[4-[[(2R)-2-[[2-[5-[(2-chloroacetyl)amino]pentanoylamino]-3-methylbutanoyl]amino]propanoyl]amino]phenyl]methyl acetate (PubChem CID 164924620) has the molecular formula C24H35ClN4O6 and a molecular weight of 511.02 g/mol. Its IUPAC name is [4-[[(2R)-2-[[2-[5-[(2-chloroacetyl)amino]pentanoylamino]-3-methylbutanoyl]amino]propanoyl]amino]phenyl]methyl acetate.
| Compound Name | [4-[[(2R)-2-[[2-[5-[(2-chloroacetyl)amino]pentanoylamino]-3-methylbutanoyl]amino]propanoyl]amino]phenyl]methyl acetate |
|---|---|
| PubChem CID | 164924620 |
| Molecular Formula | C24H35ClN4O6 |
| Molecular Weight | 511.02 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | [4-[[(2R)-2-[[2-[5-[(2-chloroacetyl)amino]pentanoylamino]-3-methylbutanoyl]amino]propanoyl]amino]phenyl]methyl acetate |
| SMILES | CC(=O)OCc1ccc(NC(=O)[C@@H](C)NC(=O)C(NC(=O)CCCCNC(=O)CCl)C(C)C)cc1 |
| InChI | InChI=1S/C24H35ClN4O6/c1-15(2)22(29-20(31)7-5-6-12-26-21(32)13-25)24(34)27-16(3)23(33)28-19-10-8-18(9-11-19)14-35-17(4)30/h8-11,15-16,22H,5-7,12-14H2,1-4H3,(H,26,32)(H,27,34)(H,28,33)(H,29,31)/t16-,22?/m1/s1 |
| InChIKey | RLNWGFBRDHVBKG-XESZBRCGSA-N |
| XLogP | 1.86 |
| TPSA | 142.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.02 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|