C16H25N3O3 — CID 170376321
[4-[2-[(3S)-7-amino-2-oxoheptan-3-yl]hydrazinyl]phenyl]methyl acetate (PubChem CID 170376321) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is [4-[2-[(3S)-7-amino-2-oxoheptan-3-yl]hydrazinyl]phenyl]methyl acetate.
| Compound Name | [4-[2-[(3S)-7-amino-2-oxoheptan-3-yl]hydrazinyl]phenyl]methyl acetate |
|---|---|
| PubChem CID | 170376321 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | [4-[2-[(3S)-7-amino-2-oxoheptan-3-yl]hydrazinyl]phenyl]methyl acetate |
| SMILES | CC(=O)OCc1ccc(NN[C@@H](CCCCN)C(C)=O)cc1 |
| InChI | InChI=1S/C16H25N3O3/c1-12(20)16(5-3-4-10-17)19-18-15-8-6-14(7-9-15)11-22-13(2)21/h6-9,16,18-19H,3-5,10-11,17H2,1-2H3/t16-/m0/s1 |
| InChIKey | YLDUYTKEUSVQEF-INIZCTEOSA-N |
| XLogP | 1.75 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|