C34H38N4O5 — CID 142189018
benzyl N-[1-[[6-amino-1-[(4-methyl-2-methylidenechromen-7-yl)amino]-1-oxohexan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 142189018) has the molecular formula C34H38N4O5 and a molecular weight of 582.70 g/mol. Its IUPAC name is benzyl N-[1-[[6-amino-1-[(4-methyl-2-methylidenechromen-7-yl)amino]-1-oxohexan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | benzyl N-[1-[[6-amino-1-[(4-methyl-2-methylidenechromen-7-yl)amino]-1-oxohexan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 142189018 |
| Molecular Formula | C34H38N4O5 |
| Molecular Weight | 582.70 g/mol |
| Exact Mass | 582.28 |
| IUPAC Name | benzyl N-[1-[[6-amino-1-[(4-methyl-2-methylidenechromen-7-yl)amino]-1-oxohexan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | C=C1C=C(C)c2ccc(NC(=O)C(CCCCN)NC(=O)C(Cc3ccccc3)NC(=O)OCc3ccccc3)cc2O1 |
| InChI | InChI=1S/C34H38N4O5/c1-23-19-24(2)43-31-21-27(16-17-28(23)31)36-32(39)29(15-9-10-18-35)37-33(40)30(20-25-11-5-3-6-12-25)38-34(41)42-22-26-13-7-4-8-14-26/h3-8,11-14,16-17,19,21,29-30H,2,9-10,15,18,20,22,35H2,1H3,(H,36,39)(H,37,40)(H,38,41) |
| InChIKey | LHGSPFQKLUXBTH-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 131.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.70 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|