C32H50N6O8 — CID 144791094
[4-[[5-(carbamoylamino)-2-[[2-[6-[(3-formyl-4-methylpentanoyl)-methylamino]hexanoylamino]acetyl]amino]pentanoyl]amino]phenyl]methyl propanoate (PubChem CID 144791094) has the molecular formula C32H50N6O8 and a molecular weight of 646.79 g/mol. Its IUPAC name is [4-[[5-(carbamoylamino)-2-[[2-[6-[(3-formyl-4-methylpentanoyl)-methylamino]hexanoylamino]acetyl]amino]pentanoyl]amino]phenyl]methyl propanoate.
| Compound Name | [4-[[5-(carbamoylamino)-2-[[2-[6-[(3-formyl-4-methylpentanoyl)-methylamino]hexanoylamino]acetyl]amino]pentanoyl]amino]phenyl]methyl propanoate |
|---|---|
| PubChem CID | 144791094 |
| Molecular Formula | C32H50N6O8 |
| Molecular Weight | 646.79 g/mol |
| Exact Mass | 646.37 |
| IUPAC Name | [4-[[5-(carbamoylamino)-2-[[2-[6-[(3-formyl-4-methylpentanoyl)-methylamino]hexanoylamino]acetyl]amino]pentanoyl]amino]phenyl]methyl propanoate |
| SMILES | CCC(=O)OCc1ccc(NC(=O)C(CCCNC(N)=O)NC(=O)CNC(=O)CCCCCN(C)C(=O)CC(C=O)C(C)C)cc1 |
| InChI | InChI=1S/C32H50N6O8/c1-5-30(43)46-21-23-12-14-25(15-13-23)36-31(44)26(10-9-16-34-32(33)45)37-28(41)19-35-27(40)11-7-6-8-17-38(4)29(42)18-24(20-39)22(2)3/h12-15,20,22,24,26H,5-11,16-19,21H2,1-4H3,(H,35,40)(H,36,44)(H,37,41)(H3,33,34,45) |
| InChIKey | QHZCRYPUIVUDEZ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 206.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.79 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|