C30H41BrF2N6O9 — CID 145163663
(2S)-2-[[4-[[2-[[2-[6-[2-(bromomethyl)prop-2-enoyloxy]heptanoylamino]acetyl]amino]-5-(carbamoylamino)pentanoyl]amino]-2,5-difluorobenzoyl]-methylamino]propanoic acid (PubChem CID 145163663) has the molecular formula C30H41BrF2N6O9 and a molecular weight of 747.59 g/mol. Its IUPAC name is (2S)-2-[[4-[[2-[[2-[6-[2-(bromomethyl)prop-2-enoyloxy]heptanoylamino]acetyl]amino]-5-(carbamoylamino)pentanoyl]amino]-2,5-difluorobenzoyl]-methylamino]propanoic acid.
| Compound Name | (2S)-2-[[4-[[2-[[2-[6-[2-(bromomethyl)prop-2-enoyloxy]heptanoylamino]acetyl]amino]-5-(carbamoylamino)pentanoyl]amino]-2,5-difluorobenzoyl]-methylamino]propanoic acid |
|---|---|
| PubChem CID | 145163663 |
| Molecular Formula | C30H41BrF2N6O9 |
| Molecular Weight | 747.59 g/mol |
| Exact Mass | 746.21 |
| IUPAC Name | (2S)-2-[[4-[[2-[[2-[6-[2-(bromomethyl)prop-2-enoyloxy]heptanoylamino]acetyl]amino]-5-(carbamoylamino)pentanoyl]amino]-2,5-difluorobenzoyl]-methylamino]propanoic acid |
| SMILES | C=C(CBr)C(=O)OC(C)CCCCC(=O)NCC(=O)NC(CCCNC(N)=O)C(=O)Nc1cc(F)c(C(=O)N(C)[C@@H](C)C(=O)O)cc1F |
| InChI | InChI=1S/C30H41BrF2N6O9/c1-16(14-31)29(46)48-17(2)8-5-6-10-24(40)36-15-25(41)37-22(9-7-11-35-30(34)47)26(42)38-23-13-20(32)19(12-21(23)33)27(43)39(4)18(3)28(44)45/h12-13,17-18,22H,1,5-11,14-15H2,2-4H3,(H,36,40)(H,37,41)(H,38,42)(H,44,45)(H3,34,35,47)/t17?,18-,22?/m0/s1 |
| InChIKey | PVQDOGCWXGRYIP-DKTYTTGXSA-N |
| XLogP | 1.94 |
| TPSA | 226.33 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.59 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|