C26H38BrN5O7 — CID 145163692
[6-[[2-[[5-(carbamoylamino)-1-(3-methoxy-4-methylanilino)-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-6-oxohexyl] 2-(bromomethyl)prop-2-enoate (PubChem CID 145163692) has the molecular formula C26H38BrN5O7 and a molecular weight of 612.52 g/mol. Its IUPAC name is [6-[[2-[[5-(carbamoylamino)-1-(3-methoxy-4-methylanilino)-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-6-oxohexyl] 2-(bromomethyl)prop-2-enoate.
| Compound Name | [6-[[2-[[5-(carbamoylamino)-1-(3-methoxy-4-methylanilino)-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-6-oxohexyl] 2-(bromomethyl)prop-2-enoate |
|---|---|
| PubChem CID | 145163692 |
| Molecular Formula | C26H38BrN5O7 |
| Molecular Weight | 612.52 g/mol |
| Exact Mass | 611.20 |
| IUPAC Name | [6-[[2-[[5-(carbamoylamino)-1-(3-methoxy-4-methylanilino)-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-6-oxohexyl] 2-(bromomethyl)prop-2-enoate |
| SMILES | C=C(CBr)C(=O)OCCCCCC(=O)NCC(=O)NC(CCCNC(N)=O)C(=O)Nc1ccc(C)c(OC)c1 |
| InChI | InChI=1S/C26H38BrN5O7/c1-17-10-11-19(14-21(17)38-3)31-24(35)20(8-7-12-29-26(28)37)32-23(34)16-30-22(33)9-5-4-6-13-39-25(36)18(2)15-27/h10-11,14,20H,2,4-9,12-13,15-16H2,1,3H3,(H,30,33)(H,31,35)(H,32,34)(H3,28,29,37) |
| InChIKey | VLTJXWOVEQBPGU-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 177.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.52 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|