C25H34BrFN6O8 — CID 167296200
[4-[[2-[[2-[6-[2-(bromomethyl)prop-2-enoyloxy]hexanoylamino]acetyl]amino]-5-(carbamoylamino)pentanoyl]amino]-2-fluorophenyl]carbamic acid (PubChem CID 167296200) has the molecular formula C25H34BrFN6O8 and a molecular weight of 645.48 g/mol. Its IUPAC name is [4-[[2-[[2-[6-[2-(bromomethyl)prop-2-enoyloxy]hexanoylamino]acetyl]amino]-5-(carbamoylamino)pentanoyl]amino]-2-fluorophenyl]carbamic acid.
| Compound Name | [4-[[2-[[2-[6-[2-(bromomethyl)prop-2-enoyloxy]hexanoylamino]acetyl]amino]-5-(carbamoylamino)pentanoyl]amino]-2-fluorophenyl]carbamic acid |
|---|---|
| PubChem CID | 167296200 |
| Molecular Formula | C25H34BrFN6O8 |
| Molecular Weight | 645.48 g/mol |
| Exact Mass | 644.16 |
| IUPAC Name | [4-[[2-[[2-[6-[2-(bromomethyl)prop-2-enoyloxy]hexanoylamino]acetyl]amino]-5-(carbamoylamino)pentanoyl]amino]-2-fluorophenyl]carbamic acid |
| SMILES | C=C(CBr)C(=O)OCCCCCC(=O)NCC(=O)NC(CCCNC(N)=O)C(=O)Nc1ccc(NC(=O)O)c(F)c1 |
| InChI | InChI=1S/C25H34BrFN6O8/c1-15(13-26)23(37)41-11-4-2-3-7-20(34)30-14-21(35)32-19(6-5-10-29-24(28)38)22(36)31-16-8-9-18(17(27)12-16)33-25(39)40/h8-9,12,19,33H,1-7,10-11,13-14H2,(H,30,34)(H,31,36)(H,32,35)(H,39,40)(H3,28,29,38) |
| InChIKey | LBAKNOINRVXPJU-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 218.05 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.48 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|