C28H37BrN6O6 — CID 145163828
[6-[[2-[[5-(carbamoylamino)-1-[(5-methylquinolin-8-yl)amino]-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-6-oxohexyl] 2-(bromomethyl)prop-2-enoate (PubChem CID 145163828) has the molecular formula C28H37BrN6O6 and a molecular weight of 633.54 g/mol. Its IUPAC name is [6-[[2-[[5-(carbamoylamino)-1-[(5-methylquinolin-8-yl)amino]-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-6-oxohexyl] 2-(bromomethyl)prop-2-enoate.
| Compound Name | [6-[[2-[[5-(carbamoylamino)-1-[(5-methylquinolin-8-yl)amino]-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-6-oxohexyl] 2-(bromomethyl)prop-2-enoate |
|---|---|
| PubChem CID | 145163828 |
| Molecular Formula | C28H37BrN6O6 |
| Molecular Weight | 633.54 g/mol |
| Exact Mass | 632.20 |
| IUPAC Name | [6-[[2-[[5-(carbamoylamino)-1-[(5-methylquinolin-8-yl)amino]-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-6-oxohexyl] 2-(bromomethyl)prop-2-enoate |
| SMILES | C=C(CBr)C(=O)OCCCCCC(=O)NCC(=O)NC(CCCNC(N)=O)C(=O)Nc1ccc(C)c2cccnc12 |
| InChI | InChI=1S/C28H37BrN6O6/c1-18-11-12-21(25-20(18)8-6-13-31-25)35-26(38)22(9-7-14-32-28(30)40)34-24(37)17-33-23(36)10-4-3-5-15-41-27(39)19(2)16-29/h6,8,11-13,22H,2-5,7,9-10,14-17H2,1H3,(H,33,36)(H,34,37)(H,35,38)(H3,30,32,40) |
| InChIKey | PNTJWQYBWMMZCX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 181.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.54 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|