C29H41BrClN7O8 — CID 145163666
(2S)-2-[[4-[[2-[[2-[6-[2-(bromomethyl)prop-2-enoylamino]hexanoylamino]acetyl]amino]-5-(carbamoylamino)pentanoyl]amino]-2-chlorobenzoyl]-methylamino]propanoic acid (PubChem CID 145163666) has the molecular formula C29H41BrClN7O8 and a molecular weight of 731.04 g/mol. Its IUPAC name is (2S)-2-[[4-[[2-[[2-[6-[2-(bromomethyl)prop-2-enoylamino]hexanoylamino]acetyl]amino]-5-(carbamoylamino)pentanoyl]amino]-2-chlorobenzoyl]-methylamino]propanoic acid.
| Compound Name | (2S)-2-[[4-[[2-[[2-[6-[2-(bromomethyl)prop-2-enoylamino]hexanoylamino]acetyl]amino]-5-(carbamoylamino)pentanoyl]amino]-2-chlorobenzoyl]-methylamino]propanoic acid |
|---|---|
| PubChem CID | 145163666 |
| Molecular Formula | C29H41BrClN7O8 |
| Molecular Weight | 731.04 g/mol |
| Exact Mass | 729.19 |
| IUPAC Name | (2S)-2-[[4-[[2-[[2-[6-[2-(bromomethyl)prop-2-enoylamino]hexanoylamino]acetyl]amino]-5-(carbamoylamino)pentanoyl]amino]-2-chlorobenzoyl]-methylamino]propanoic acid |
| SMILES | C=C(CBr)C(=O)NCCCCCC(=O)NCC(=O)NC(CCCNC(N)=O)C(=O)Nc1ccc(C(=O)N(C)[C@@H](C)C(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C29H41BrClN7O8/c1-17(15-30)25(41)33-12-6-4-5-9-23(39)35-16-24(40)37-22(8-7-13-34-29(32)46)26(42)36-19-10-11-20(21(31)14-19)27(43)38(3)18(2)28(44)45/h10-11,14,18,22H,1,4-9,12-13,15-16H2,2-3H3,(H,33,41)(H,35,39)(H,36,42)(H,37,40)(H,44,45)(H3,32,34,46)/t18-,22?/m0/s1 |
| InChIKey | JASYBUVESKZFAH-HXBUSHRASA-N |
| XLogP | 1.50 |
| TPSA | 229.13 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.04 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|