C27H38N6O9S — CID 167525376
3-[[(2S)-5-(carbamoylamino)-2-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]pentanoyl]amino]benzenesulfonic acid (PubChem CID 167525376) has the molecular formula C27H38N6O9S and a molecular weight of 622.70 g/mol. Its IUPAC name is 3-[[(2S)-5-(carbamoylamino)-2-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]pentanoyl]amino]benzenesulfonic acid.
| Compound Name | 3-[[(2S)-5-(carbamoylamino)-2-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]pentanoyl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 167525376 |
| Molecular Formula | C27H38N6O9S |
| Molecular Weight | 622.70 g/mol |
| Exact Mass | 622.24 |
| IUPAC Name | 3-[[(2S)-5-(carbamoylamino)-2-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]pentanoyl]amino]benzenesulfonic acid |
| SMILES | CC(C)[C@H](NC(=O)CCCCCN1C(=O)C=CC1=O)C(=O)N[C@@H](CCCNC(N)=O)C(=O)Nc1cccc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C27H38N6O9S/c1-17(2)24(32-21(34)11-4-3-5-15-33-22(35)12-13-23(33)36)26(38)31-20(10-7-14-29-27(28)39)25(37)30-18-8-6-9-19(16-18)43(40,41)42/h6,8-9,12-13,16-17,20,24H,3-5,7,10-11,14-15H2,1-2H3,(H,30,37)(H,31,38)(H,32,34)(H3,28,29,39)(H,40,41,42)/t20-,24-/m0/s1 |
| InChIKey | VDXDNJLWHUQAKX-RDPSFJRHSA-N |
| XLogP | 0.43 |
| TPSA | 234.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.70 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|