C35H52N6O8 — CID 170210246
1-[4-[[(2S)-5-(carbamoylamino)-2-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]ethyl 3,3-dimethylbutanoate (PubChem CID 170210246) has the molecular formula C35H52N6O8 and a molecular weight of 684.84 g/mol. Its IUPAC name is 1-[4-[[(2S)-5-(carbamoylamino)-2-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]ethyl 3,3-dimethylbutanoate.
| Compound Name | 1-[4-[[(2S)-5-(carbamoylamino)-2-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]ethyl 3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 170210246 |
| Molecular Formula | C35H52N6O8 |
| Molecular Weight | 684.84 g/mol |
| Exact Mass | 684.38 |
| IUPAC Name | 1-[4-[[(2S)-5-(carbamoylamino)-2-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]ethyl 3,3-dimethylbutanoate |
| SMILES | CC(OC(=O)CC(C)(C)C)c1ccc(NC(=O)[C@H](CCCNC(N)=O)NC(=O)C(NC(=O)CCCCCN2C(=O)C=CC2=O)C(C)C)cc1 |
| InChI | InChI=1S/C35H52N6O8/c1-22(2)31(40-27(42)12-8-7-9-20-41-28(43)17-18-29(41)44)33(47)39-26(11-10-19-37-34(36)48)32(46)38-25-15-13-24(14-16-25)23(3)49-30(45)21-35(4,5)6/h13-18,22-23,26,31H,7-12,19-21H2,1-6H3,(H,38,46)(H,39,47)(H,40,42)(H3,36,37,48)/t23?,26-,31?/m0/s1 |
| InChIKey | CAMCPUIGQLVEJY-PNDBIIQMSA-N |
| XLogP | 3.22 |
| TPSA | 206.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.84 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|