C15H31N5O3S — CID 146434367
5-(carbamoylamino)-2-[[3-methyl-2-(methylsulfanylamino)butanoyl]amino]-N-propan-2-ylpentanamide (PubChem CID 146434367) has the molecular formula C15H31N5O3S and a molecular weight of 361.51 g/mol. Its IUPAC name is 5-(carbamoylamino)-2-[[3-methyl-2-(methylsulfanylamino)butanoyl]amino]-N-propan-2-ylpentanamide.
| Compound Name | 5-(carbamoylamino)-2-[[3-methyl-2-(methylsulfanylamino)butanoyl]amino]-N-propan-2-ylpentanamide |
|---|---|
| PubChem CID | 146434367 |
| Molecular Formula | C15H31N5O3S |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | 5-(carbamoylamino)-2-[[3-methyl-2-(methylsulfanylamino)butanoyl]amino]-N-propan-2-ylpentanamide |
| SMILES | CSNC(C(=O)NC(CCCNC(N)=O)C(=O)NC(C)C)C(C)C |
| InChI | InChI=1S/C15H31N5O3S/c1-9(2)12(20-24-5)14(22)19-11(13(21)18-10(3)4)7-6-8-17-15(16)23/h9-12,20H,6-8H2,1-5H3,(H,18,21)(H,19,22)(H3,16,17,23) |
| InChIKey | FFXMIULQTHEUGA-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 125.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|