C16H30N4O5 — CID 175778130
tert-butyl (3S)-3-[[(2S)-2-amino-5-(carbamoylamino)pentanoyl]amino]-4-methyl-2-oxopentanoate (PubChem CID 175778130) has the molecular formula C16H30N4O5 and a molecular weight of 358.44 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[(2S)-2-amino-5-(carbamoylamino)pentanoyl]amino]-4-methyl-2-oxopentanoate.
| Compound Name | tert-butyl (3S)-3-[[(2S)-2-amino-5-(carbamoylamino)pentanoyl]amino]-4-methyl-2-oxopentanoate |
|---|---|
| PubChem CID | 175778130 |
| Molecular Formula | C16H30N4O5 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | tert-butyl (3S)-3-[[(2S)-2-amino-5-(carbamoylamino)pentanoyl]amino]-4-methyl-2-oxopentanoate |
| SMILES | CC(C)[C@H](NC(=O)[C@@H](N)CCCNC(N)=O)C(=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H30N4O5/c1-9(2)11(12(21)14(23)25-16(3,4)5)20-13(22)10(17)7-6-8-19-15(18)24/h9-11H,6-8,17H2,1-5H3,(H,20,22)(H3,18,19,24)/t10-,11-/m0/s1 |
| InChIKey | GIFWXLWROVCEQH-QWRGUYRKSA-N |
| XLogP | -0.19 |
| TPSA | 153.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|