C26H36IN5O5 — CID 170116014
benzyl N-[1-[[5-[[amino(hydroxy)methyl]amino]-1-[4-(iodomethyl)anilino]-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 170116014) has the molecular formula C26H36IN5O5 and a molecular weight of 625.51 g/mol. Its IUPAC name is benzyl N-[1-[[5-[[amino(hydroxy)methyl]amino]-1-[4-(iodomethyl)anilino]-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | benzyl N-[1-[[5-[[amino(hydroxy)methyl]amino]-1-[4-(iodomethyl)anilino]-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 170116014 |
| Molecular Formula | C26H36IN5O5 |
| Molecular Weight | 625.51 g/mol |
| Exact Mass | 625.18 |
| IUPAC Name | benzyl N-[1-[[5-[[amino(hydroxy)methyl]amino]-1-[4-(iodomethyl)anilino]-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)C(NC(=O)OCc1ccccc1)C(=O)NC(CCCNC(N)O)C(=O)Nc1ccc(CI)cc1 |
| InChI | InChI=1S/C26H36IN5O5/c1-17(2)22(32-26(36)37-16-19-7-4-3-5-8-19)24(34)31-21(9-6-14-29-25(28)35)23(33)30-20-12-10-18(15-27)11-13-20/h3-5,7-8,10-13,17,21-22,25,29,35H,6,9,14-16,28H2,1-2H3,(H,30,33)(H,31,34)(H,32,36) |
| InChIKey | ZKTZFBDAYGTHER-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 154.81 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.51 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|