C24H38N6O6 — CID 163582108
(2R)-N-[4-(methylaminooxymethyl)phenyl]-5-(methylcarbamoylamino)-2-[[(2R)-3-methyl-2-(3-oxobutanoylamino)butanoyl]amino]pentanamide (PubChem CID 163582108) has the molecular formula C24H38N6O6 and a molecular weight of 506.60 g/mol. Its IUPAC name is (2R)-N-[4-(methylaminooxymethyl)phenyl]-5-(methylcarbamoylamino)-2-[[(2R)-3-methyl-2-(3-oxobutanoylamino)butanoyl]amino]pentanamide.
| Compound Name | (2R)-N-[4-(methylaminooxymethyl)phenyl]-5-(methylcarbamoylamino)-2-[[(2R)-3-methyl-2-(3-oxobutanoylamino)butanoyl]amino]pentanamide |
|---|---|
| PubChem CID | 163582108 |
| Molecular Formula | C24H38N6O6 |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.29 |
| IUPAC Name | (2R)-N-[4-(methylaminooxymethyl)phenyl]-5-(methylcarbamoylamino)-2-[[(2R)-3-methyl-2-(3-oxobutanoylamino)butanoyl]amino]pentanamide |
| SMILES | CNOCc1ccc(NC(=O)[C@@H](CCCNC(=O)NC)NC(=O)[C@H](NC(=O)CC(C)=O)C(C)C)cc1 |
| InChI | InChI=1S/C24H38N6O6/c1-15(2)21(30-20(32)13-16(3)31)23(34)29-19(7-6-12-27-24(35)25-4)22(33)28-18-10-8-17(9-11-18)14-36-26-5/h8-11,15,19,21,26H,6-7,12-14H2,1-5H3,(H,28,33)(H,29,34)(H,30,32)(H2,25,27,35)/t19-,21-/m1/s1 |
| InChIKey | GIKMJWLETLPOGH-TZIWHRDSSA-N |
| XLogP | 0.59 |
| TPSA | 166.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|