C35H53N7O8 — CID 170372549
(4-aminophenyl) [4-[[(2S)-2-[[2-[4-[2-(dimethylamino)ethoxy]pentanoylamino]-3-methylbutanoyl]amino]-5-(methylcarbamoylamino)pentanoyl]amino]phenyl]methyl carbonate (PubChem CID 170372549) has the molecular formula C35H53N7O8 and a molecular weight of 699.85 g/mol. Its IUPAC name is (4-aminophenyl) [4-[[(2S)-2-[[2-[4-[2-(dimethylamino)ethoxy]pentanoylamino]-3-methylbutanoyl]amino]-5-(methylcarbamoylamino)pentanoyl]amino]phenyl]methyl carbonate.
| Compound Name | (4-aminophenyl) [4-[[(2S)-2-[[2-[4-[2-(dimethylamino)ethoxy]pentanoylamino]-3-methylbutanoyl]amino]-5-(methylcarbamoylamino)pentanoyl]amino]phenyl]methyl carbonate |
|---|---|
| PubChem CID | 170372549 |
| Molecular Formula | C35H53N7O8 |
| Molecular Weight | 699.85 g/mol |
| Exact Mass | 699.40 |
| IUPAC Name | (4-aminophenyl) [4-[[(2S)-2-[[2-[4-[2-(dimethylamino)ethoxy]pentanoylamino]-3-methylbutanoyl]amino]-5-(methylcarbamoylamino)pentanoyl]amino]phenyl]methyl carbonate |
| SMILES | CNC(=O)NCCC[C@H](NC(=O)C(NC(=O)CCC(C)OCCN(C)C)C(C)C)C(=O)Nc1ccc(COC(=O)Oc2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C35H53N7O8/c1-23(2)31(41-30(43)18-9-24(3)48-21-20-42(5)6)33(45)40-29(8-7-19-38-34(46)37-4)32(44)39-27-14-10-25(11-15-27)22-49-35(47)50-28-16-12-26(36)13-17-28/h10-17,23-24,29,31H,7-9,18-22,36H2,1-6H3,(H,39,44)(H,40,45)(H,41,43)(H2,37,38,46)/t24?,29-,31?/m0/s1 |
| InChIKey | RWHHTCKIBXGXMN-DOVHFGBNSA-N |
| XLogP | 3.00 |
| TPSA | 202.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.85 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|