C8H20N4O9P2 — CID 140554594
[[(2S)-5-(carbamoylamino)-2-(hydroxyamino)pentanoyl]-(phosphonomethyl)amino]methylphosphonic acid (PubChem CID 140554594) has the molecular formula C8H20N4O9P2 and a molecular weight of 378.22 g/mol. Its IUPAC name is [[(2S)-5-(carbamoylamino)-2-(hydroxyamino)pentanoyl]-(phosphonomethyl)amino]methylphosphonic acid.
| Compound Name | [[(2S)-5-(carbamoylamino)-2-(hydroxyamino)pentanoyl]-(phosphonomethyl)amino]methylphosphonic acid |
|---|---|
| PubChem CID | 140554594 |
| Molecular Formula | C8H20N4O9P2 |
| Molecular Weight | 378.22 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | [[(2S)-5-(carbamoylamino)-2-(hydroxyamino)pentanoyl]-(phosphonomethyl)amino]methylphosphonic acid |
| SMILES | NC(=O)NCCC[C@H](NO)C(=O)N(CP(=O)(O)O)CP(=O)(O)O |
| InChI | InChI=1S/C8H20N4O9P2/c9-8(14)10-3-1-2-6(11-15)7(13)12(4-22(16,17)18)5-23(19,20)21/h6,11,15H,1-5H2,(H3,9,10,14)(H2,16,17,18)(H2,19,20,21)/t6-/m0/s1 |
| InChIKey | JRHOGILPQPPAKF-LURJTMIESA-N |
| XLogP | -2.12 |
| TPSA | 222.75 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.22 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|