C9H23N3O7P2 — CID 140554538
[[(2S)-6-amino-2-(methylamino)hexanoyl]-(phosphonomethyl)amino]methylphosphonic acid (PubChem CID 140554538) has the molecular formula C9H23N3O7P2 and a molecular weight of 347.25 g/mol. Its IUPAC name is [[(2S)-6-amino-2-(methylamino)hexanoyl]-(phosphonomethyl)amino]methylphosphonic acid.
| Compound Name | [[(2S)-6-amino-2-(methylamino)hexanoyl]-(phosphonomethyl)amino]methylphosphonic acid |
|---|---|
| PubChem CID | 140554538 |
| Molecular Formula | C9H23N3O7P2 |
| Molecular Weight | 347.25 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | [[(2S)-6-amino-2-(methylamino)hexanoyl]-(phosphonomethyl)amino]methylphosphonic acid |
| SMILES | CN[C@@H](CCCCN)C(=O)N(CP(=O)(O)O)CP(=O)(O)O |
| InChI | InChI=1S/C9H23N3O7P2/c1-11-8(4-2-3-5-10)9(13)12(6-20(14,15)16)7-21(17,18)19/h8,11H,2-7,10H2,1H3,(H2,14,15,16)(H2,17,18,19)/t8-/m0/s1 |
| InChIKey | BOBYJFJJPJJJGM-QMMMGPOBSA-N |
| XLogP | -1.20 |
| TPSA | 173.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.25 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|