C8H14N2O4S — CID 174837423
2-[(1-amino-2-oxo-2-prop-2-enoxyethyl)amino]-3-sulfanylpropanoic acid (PubChem CID 174837423) has the molecular formula C8H14N2O4S and a molecular weight of 234.28 g/mol. Its IUPAC name is 2-[(1-amino-2-oxo-2-prop-2-enoxyethyl)amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[(1-amino-2-oxo-2-prop-2-enoxyethyl)amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 174837423 |
| Molecular Formula | C8H14N2O4S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 2-[(1-amino-2-oxo-2-prop-2-enoxyethyl)amino]-3-sulfanylpropanoic acid |
| SMILES | C=CCOC(=O)C(N)NC(CS)C(=O)O |
| InChI | InChI=1S/C8H14N2O4S/c1-2-3-14-8(13)6(9)10-5(4-15)7(11)12/h2,5-6,10,15H,1,3-4,9H2,(H,11,12) |
| InChIKey | RMFFMSMXXMYPCG-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|