C5H10N2O2S — CID 149433548
(2S)-2-[[(Z)-2-aminoethenyl]amino]-3-sulfanylpropanoic acid (PubChem CID 149433548) has the molecular formula C5H10N2O2S and a molecular weight of 162.21 g/mol. Its IUPAC name is (2S)-2-[[(Z)-2-aminoethenyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | (2S)-2-[[(Z)-2-aminoethenyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 149433548 |
| Molecular Formula | C5H10N2O2S |
| Molecular Weight | 162.21 g/mol |
| Exact Mass | 162.05 |
| IUPAC Name | (2S)-2-[[(Z)-2-aminoethenyl]amino]-3-sulfanylpropanoic acid |
| SMILES | N/C=C\N[C@H](CS)C(=O)O |
| InChI | InChI=1S/C5H10N2O2S/c6-1-2-7-4(3-10)5(8)9/h1-2,4,7,10H,3,6H2,(H,8,9)/b2-1-/t4-/m1/s1 |
| InChIKey | NFRUXKJKJOUVRZ-HYLWAGPFSA-N |
| XLogP | -0.61 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.21 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|