C8H13NO5 — CID 174428685
2-amino-3-(hydroxymethyl)-4-oxo-4-prop-2-enoxybutanoic acid (PubChem CID 174428685) has the molecular formula C8H13NO5 and a molecular weight of 203.19 g/mol. Its IUPAC name is 2-amino-3-(hydroxymethyl)-4-oxo-4-prop-2-enoxybutanoic acid.
| Compound Name | 2-amino-3-(hydroxymethyl)-4-oxo-4-prop-2-enoxybutanoic acid |
|---|---|
| PubChem CID | 174428685 |
| Molecular Formula | C8H13NO5 |
| Molecular Weight | 203.19 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | 2-amino-3-(hydroxymethyl)-4-oxo-4-prop-2-enoxybutanoic acid |
| SMILES | C=CCOC(=O)C(CO)C(N)C(=O)O |
| InChI | InChI=1S/C8H13NO5/c1-2-3-14-8(13)5(4-10)6(9)7(11)12/h2,5-6,10H,1,3-4,9H2,(H,11,12) |
| InChIKey | RYHMNFCHUNQDEX-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.19 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|