C8H15NO2S — CID 86346309
prop-2-enyl (2R)-2-amino-4-methylsulfanylbutanoate (PubChem CID 86346309) has the molecular formula C8H15NO2S and a molecular weight of 189.28 g/mol. Its IUPAC name is prop-2-enyl (2R)-2-amino-4-methylsulfanylbutanoate.
| Compound Name | prop-2-enyl (2R)-2-amino-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 86346309 |
| Molecular Formula | C8H15NO2S |
| Molecular Weight | 189.28 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | prop-2-enyl (2R)-2-amino-4-methylsulfanylbutanoate |
| SMILES | C=CCOC(=O)[C@H](N)CCSC |
| InChI | InChI=1S/C8H15NO2S/c1-3-5-11-8(10)7(9)4-6-12-2/h3,7H,1,4-6,9H2,2H3/t7-/m1/s1 |
| InChIKey | LYFIDLJDRXPGEI-SSDOTTSWSA-N |
| XLogP | 0.80 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.28 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|