C21H39N3O8S3 — CID 87480288
2,3-bis[[(2S)-2-amino-4-methylsulfanylbutanoyl]oxy]propyl (2S)-2-amino-4-methylsulfanylbutanoate;prop-2-enoic acid (PubChem CID 87480288) has the molecular formula C21H39N3O8S3 and a molecular weight of 557.76 g/mol. Its IUPAC name is 2,3-bis[[(2S)-2-amino-4-methylsulfanylbutanoyl]oxy]propyl (2S)-2-amino-4-methylsulfanylbutanoate;prop-2-enoic acid.
| Compound Name | 2,3-bis[[(2S)-2-amino-4-methylsulfanylbutanoyl]oxy]propyl (2S)-2-amino-4-methylsulfanylbutanoate;prop-2-enoic acid |
|---|---|
| PubChem CID | 87480288 |
| Molecular Formula | C21H39N3O8S3 |
| Molecular Weight | 557.76 g/mol |
| Exact Mass | 557.19 |
| IUPAC Name | 2,3-bis[[(2S)-2-amino-4-methylsulfanylbutanoyl]oxy]propyl (2S)-2-amino-4-methylsulfanylbutanoate;prop-2-enoic acid |
| SMILES | C=CC(=O)O.CSCC[C@H](N)C(=O)OCC(COC(=O)[C@@H](N)CCSC)OC(=O)[C@@H](N)CCSC |
| InChI | InChI=1S/C18H35N3O6S3.C3H4O2/c1-28-7-4-13(19)16(22)25-10-12(27-18(24)15(21)6-9-30-3)11-26-17(23)14(20)5-8-29-2;1-2-3(4)5/h12-15H,4-11,19-21H2,1-3H3;2H,1H2,(H,4,5)/t13-,14-,15-;/m0./s1 |
| InChIKey | HLPAAIBLBNDVOU-WDTSGDEMSA-N |
| XLogP | 0.48 |
| TPSA | 194.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.76 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|