C41H79NO2S — CID 170781223
[(9Z,27Z)-hexatriaconta-9,27-dien-18-yl] (2S)-2-amino-4-methylsulfanylbutanoate (PubChem CID 170781223) has the molecular formula C41H79NO2S and a molecular weight of 650.16 g/mol. Its IUPAC name is [(9Z,27Z)-hexatriaconta-9,27-dien-18-yl] (2S)-2-amino-4-methylsulfanylbutanoate.
| Compound Name | [(9Z,27Z)-hexatriaconta-9,27-dien-18-yl] (2S)-2-amino-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 170781223 |
| Molecular Formula | C41H79NO2S |
| Molecular Weight | 650.16 g/mol |
| Exact Mass | 649.58 |
| IUPAC Name | [(9Z,27Z)-hexatriaconta-9,27-dien-18-yl] (2S)-2-amino-4-methylsulfanylbutanoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCC(CCCCCCC/C=C\CCCCCCCC)OC(=O)[C@@H](N)CCSC |
| InChI | InChI=1S/C41H79NO2S/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-39(44-41(43)40(42)37-38-45-3)35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h18-21,39-40H,4-17,22-38,42H2,1-3H3/b20-18-,21-19-/t39?,40-/m0/s1 |
| InChIKey | VMFNMQRCYRRJJD-ZGXRSGOTSA-N |
| XLogP | 13.44 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.16 |
| LogP ≤ 5 | 13.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|