C7H10F3NO5S — CID 175959780
(2R)-2-(2-oxoethylamino)-3-sulfanylpropanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 175959780) has the molecular formula C7H10F3NO5S and a molecular weight of 277.22 g/mol. Its IUPAC name is (2R)-2-(2-oxoethylamino)-3-sulfanylpropanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (2R)-2-(2-oxoethylamino)-3-sulfanylpropanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175959780 |
| Molecular Formula | C7H10F3NO5S |
| Molecular Weight | 277.22 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | (2R)-2-(2-oxoethylamino)-3-sulfanylpropanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=CCN[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C5H9NO3S.C2HF3O2/c7-2-1-6-4(3-10)5(8)9;3-2(4,5)1(6)7/h2,4,6,10H,1,3H2,(H,8,9);(H,6,7)/t4-;/m0./s1 |
| InChIKey | LHNBCDQPUDYJRR-WCCKRBBISA-N |
| XLogP | -0.21 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.22 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|