C6H14NO6P — CID 90871035
(2S)-3-ethoxy-2-(phosphonomethylamino)propanoic acid (PubChem CID 90871035) has the molecular formula C6H14NO6P and a molecular weight of 227.15 g/mol. Its IUPAC name is (2S)-3-ethoxy-2-(phosphonomethylamino)propanoic acid.
| Compound Name | (2S)-3-ethoxy-2-(phosphonomethylamino)propanoic acid |
|---|---|
| PubChem CID | 90871035 |
| Molecular Formula | C6H14NO6P |
| Molecular Weight | 227.15 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | (2S)-3-ethoxy-2-(phosphonomethylamino)propanoic acid |
| SMILES | CCOC[C@H](NCP(=O)(O)O)C(=O)O |
| InChI | InChI=1S/C6H14NO6P/c1-2-13-3-5(6(8)9)7-4-14(10,11)12/h5,7H,2-4H2,1H3,(H,8,9)(H2,10,11,12)/t5-/m0/s1 |
| InChIKey | KNKNTLLQUFWPDX-YFKPBYRVSA-N |
| XLogP | -0.80 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.15 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|