About 3-(2,2-difluoroethoxy)-2-(ethylamino)propanoic acid
3-(2,2-difluoroethoxy)-2-(ethylamino)propanoic acid (PubChem CID 82005662) has the molecular formula C7H13F2NO3
and a molecular weight of 197.18 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-2-(ethylamino)propanoic acid.
Molecular Properties
| Compound Name | 3-(2,2-difluoroethoxy)-2-(ethylamino)propanoic acid |
| PubChem CID | 82005662 |
| Molecular Formula | C7H13F2NO3 |
| Molecular Weight | 197.18 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-2-(ethylamino)propanoic acid |
| SMILES | CCNC(COCC(F)F)C(=O)O |
| InChI | InChI=1S/C7H13F2NO3/c1-2-10-5(7(11)12)3-13-4-6(8)9/h5-6,10H,2-4H2,1H3,(H,11,12) |
| InChIKey | PNMTTZUDIJCPKL-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.18 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2,2-difluoroethoxy)-2-(ethylamino)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2-difluoroethoxy)-2-(ethylamino)propanoic acid?
The IUPAC name of 3-(2,2-difluoroethoxy)-2-(ethylamino)propanoic acid (CID 82005662) is 3-(2,2-difluoroethoxy)-2-(ethylamino)propanoic acid.
What is the SMILES notation for 3-(2,2-difluoroethoxy)-2-(ethylamino)propanoic acid?
The canonical SMILES for 3-(2,2-difluoroethoxy)-2-(ethylamino)propanoic acid is CCNC(COCC(F)F)C(=O)O.
What is the InChIKey of 3-(2,2-difluoroethoxy)-2-(ethylamino)propanoic acid?
The InChIKey is PNMTTZUDIJCPKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13F2NO3/c1-2-10-5(7(11)12)3-13-4-6(8)9/h5-6,10H,2-4H2,1H3,(H,11,12).
What are the key properties of 3-(2,2-difluoroethoxy)-2-(ethylamino)propanoic acid?
3-(2,2-difluoroethoxy)-2-(ethylamino)propanoic acid has a molecular weight of 197.18 g/mol, XLogP of 0.33, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-difluoroethoxy)-2-(ethylamino)propanoic acid is sourced from PubChem (CID 82005662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).