3-(2,2-difluoroethoxy)-2-(ethylamino)propanoic acid

C7H13F2NO3 — CID 82005662

IUPAC3-(2,2-difluoroethoxy)-2-(ethylamino)propanoic acid
SMILESCCNC(COCC(F)F)C(=O)O
InChIInChI=1S/C7H13F2NO3/c1-2-10-5(7(11)12)3-13-4-6(8)9/h5-6,10H,2-4H2,1H3,(H,11,12)
InChIKeyPNMTTZUDIJCPKL-UHFFFAOYSA-N
MW197.18 g/mol
LogP0.33
Rot. Bonds7

About 3-(2,2-difluoroethoxy)-2-(ethylamino)propanoic acid

3-(2,2-difluoroethoxy)-2-(ethylamino)propanoic acid (PubChem CID 82005662) has the molecular formula C7H13F2NO3 and a molecular weight of 197.18 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-2-(ethylamino)propanoic acid.

Molecular Properties

Compound Name3-(2,2-difluoroethoxy)-2-(ethylamino)propanoic acid
PubChem CID82005662
Molecular FormulaC7H13F2NO3
Molecular Weight197.18 g/mol
Exact Mass197.09
IUPAC Name3-(2,2-difluoroethoxy)-2-(ethylamino)propanoic acid
SMILESCCNC(COCC(F)F)C(=O)O
InChIInChI=1S/C7H13F2NO3/c1-2-10-5(7(11)12)3-13-4-6(8)9/h5-6,10H,2-4H2,1H3,(H,11,12)
InChIKeyPNMTTZUDIJCPKL-UHFFFAOYSA-N
XLogP0.33
TPSA58.56 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500197.18
LogP ≤ 50.33
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3-(2,2-difluoroethoxy)-2-(ethylamino)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-(ethylamino)-3-[2-(2-methoxyethoxy)ethoxy]propanoic acid
CID 104565225
(2S)-2-(ethylamino)-3-methoxypropanoic acid
CID 149367077
(2S)-2-(ethylamino)-3-hydroxypropanoic acid
CID 12003152
2-(ethylamino)-4-propoxybutanoic acid
CID 63034950
2-[2-(2,2-difluoroethoxy)ethylcarbamoylamino]pentanoic acid
CID 114128613
2-(ethylamino)-4-(2-propoxyethoxy)butanoic acid
CID 63685674
(2R)-2-[3-(2,2-difluoroethoxy)propanoylamino]pentanoic acid
CID 107562818
2-(ethylamino)-4-(2,2,2-trifluoroethoxy)butanoic acid
CID 63039882
3-(2-fluoropropoxy)-2-methylpropanoic acid
CID 84651804
acetic acid;2-(ethylamino)-3-hydroxypropanoic acid
CID 87797197
(2S)-3-ethoxy-2-(phosphonomethylamino)propanoic acid
CID 90871035
1-(2,2-difluoroethoxy)-N-ethylpentan-2-amine
CID 82005063

Frequently Asked Questions

What is the IUPAC name of 3-(2,2-difluoroethoxy)-2-(ethylamino)propanoic acid?
The IUPAC name of 3-(2,2-difluoroethoxy)-2-(ethylamino)propanoic acid (CID 82005662) is 3-(2,2-difluoroethoxy)-2-(ethylamino)propanoic acid.
What is the SMILES notation for 3-(2,2-difluoroethoxy)-2-(ethylamino)propanoic acid?
The canonical SMILES for 3-(2,2-difluoroethoxy)-2-(ethylamino)propanoic acid is CCNC(COCC(F)F)C(=O)O.
What is the InChIKey of 3-(2,2-difluoroethoxy)-2-(ethylamino)propanoic acid?
The InChIKey is PNMTTZUDIJCPKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13F2NO3/c1-2-10-5(7(11)12)3-13-4-6(8)9/h5-6,10H,2-4H2,1H3,(H,11,12).
What are the key properties of 3-(2,2-difluoroethoxy)-2-(ethylamino)propanoic acid?
3-(2,2-difluoroethoxy)-2-(ethylamino)propanoic acid has a molecular weight of 197.18 g/mol, XLogP of 0.33, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-difluoroethoxy)-2-(ethylamino)propanoic acid is sourced from PubChem (CID 82005662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).