About (2S)-1,4-dihydroxy-1,4-dioxo-2-(sulfinatoamino)butane
(2S)-1,4-dihydroxy-1,4-dioxo-2-(sulfinatoamino)butane (PubChem CID 174452420) has the molecular formula C4H6NO6S-
and a molecular weight of 196.16 g/mol. Its IUPAC name is (2S)-1,4-dihydroxy-1,4-dioxo-2-(sulfinatoamino)butane.
Molecular Properties
| Compound Name | (2S)-1,4-dihydroxy-1,4-dioxo-2-(sulfinatoamino)butane |
| PubChem CID | 174452420 |
| Molecular Formula | C4H6NO6S- |
| Molecular Weight | 196.16 g/mol |
| Exact Mass | 195.99 |
| IUPAC Name | (2S)-1,4-dihydroxy-1,4-dioxo-2-(sulfinatoamino)butane |
| SMILES | O=C(O)C[C@H](NS(=O)[O-])C(=O)O |
| InChI | InChI=1S/C4H7NO6S/c6-3(7)1-2(4(8)9)5-12(10)11/h2,5H,1H2,(H,6,7)(H,8,9)(H,10,11)/p-1/t2-/m0/s1 |
| InChIKey | SSXLSQJPPSJYGN-REOHCLBHSA-M |
| XLogP | -1.70 |
| TPSA | 126.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.16 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze (2S)-1,4-dihydroxy-1,4-dioxo-2-(sulfinatoamino)butane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1,4-dihydroxy-1,4-dioxo-2-(sulfinatoamino)butane?
The IUPAC name of (2S)-1,4-dihydroxy-1,4-dioxo-2-(sulfinatoamino)butane (CID 174452420) is (2S)-1,4-dihydroxy-1,4-dioxo-2-(sulfinatoamino)butane.
What is the SMILES notation for (2S)-1,4-dihydroxy-1,4-dioxo-2-(sulfinatoamino)butane?
The canonical SMILES for (2S)-1,4-dihydroxy-1,4-dioxo-2-(sulfinatoamino)butane is O=C(O)C[C@H](NS(=O)[O-])C(=O)O.
What is the InChIKey of (2S)-1,4-dihydroxy-1,4-dioxo-2-(sulfinatoamino)butane?
The InChIKey is SSXLSQJPPSJYGN-REOHCLBHSA-M. The full InChI is InChI=1S/C4H7NO6S/c6-3(7)1-2(4(8)9)5-12(10)11/h2,5H,1H2,(H,6,7)(H,8,9)(H,10,11)/p-1/t2-/m0/s1.
What are the key properties of (2S)-1,4-dihydroxy-1,4-dioxo-2-(sulfinatoamino)butane?
(2S)-1,4-dihydroxy-1,4-dioxo-2-(sulfinatoamino)butane has a molecular weight of 196.16 g/mol, XLogP of -1.70, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1,4-dihydroxy-1,4-dioxo-2-(sulfinatoamino)butane is sourced from PubChem (CID 174452420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).