C6H12NO4S- — CID 174657051
(2R)-1-hydroxy-4-methyl-1-oxo-2-(sulfinatoamino)pentane (PubChem CID 174657051) has the molecular formula C6H12NO4S- and a molecular weight of 194.23 g/mol. Its IUPAC name is (2R)-1-hydroxy-4-methyl-1-oxo-2-(sulfinatoamino)pentane.
| Compound Name | (2R)-1-hydroxy-4-methyl-1-oxo-2-(sulfinatoamino)pentane |
|---|---|
| PubChem CID | 174657051 |
| Molecular Formula | C6H12NO4S- |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | (2R)-1-hydroxy-4-methyl-1-oxo-2-(sulfinatoamino)pentane |
| SMILES | CC(C)C[C@@H](NS(=O)[O-])C(=O)O |
| InChI | InChI=1S/C6H13NO4S/c1-4(2)3-5(6(8)9)7-12(10)11/h4-5,7H,3H2,1-2H3,(H,8,9)(H,10,11)/p-1/t5-/m1/s1 |
| InChIKey | MXIHMITZVOROKH-RXMQYKEDSA-M |
| XLogP | -0.13 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|