C6H10NO5P — CID 57011297
(2S)-2-[(2-phosphanylacetyl)amino]butanedioic acid (PubChem CID 57011297) has the molecular formula C6H10NO5P and a molecular weight of 207.12 g/mol. Its IUPAC name is (2S)-2-[(2-phosphanylacetyl)amino]butanedioic acid.
| Compound Name | (2S)-2-[(2-phosphanylacetyl)amino]butanedioic acid |
|---|---|
| PubChem CID | 57011297 |
| Molecular Formula | C6H10NO5P |
| Molecular Weight | 207.12 g/mol |
| Exact Mass | 207.03 |
| IUPAC Name | (2S)-2-[(2-phosphanylacetyl)amino]butanedioic acid |
| SMILES | O=C(O)C[C@H](NC(=O)CP)C(=O)O |
| InChI | InChI=1S/C6H10NO5P/c8-4(2-13)7-3(6(11)12)1-5(9)10/h3H,1-2,13H2,(H,7,8)(H,9,10)(H,11,12)/t3-/m0/s1 |
| InChIKey | CQYLMGRWSSMEHA-VKHMYHEASA-N |
| XLogP | -1.09 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.12 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|