C8H8F3NO5 — CID 131848287
(2S)-2-(3,4,4-trifluorobut-3-enoylamino)butanedioic acid (PubChem CID 131848287) has the molecular formula C8H8F3NO5 and a molecular weight of 255.15 g/mol. Its IUPAC name is (2S)-2-(3,4,4-trifluorobut-3-enoylamino)butanedioic acid.
| Compound Name | (2S)-2-(3,4,4-trifluorobut-3-enoylamino)butanedioic acid |
|---|---|
| PubChem CID | 131848287 |
| Molecular Formula | C8H8F3NO5 |
| Molecular Weight | 255.15 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | (2S)-2-(3,4,4-trifluorobut-3-enoylamino)butanedioic acid |
| SMILES | O=C(O)C[C@H](NC(=O)CC(F)=C(F)F)C(=O)O |
| InChI | InChI=1S/C8H8F3NO5/c9-3(7(10)11)1-5(13)12-4(8(16)17)2-6(14)15/h4H,1-2H2,(H,12,13)(H,14,15)(H,16,17)/t4-/m0/s1 |
| InChIKey | QXNLUDWHYNWQOV-BYPYZUCNSA-N |
| XLogP | 0.50 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.15 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |