(2S)-2-(3,4,4-trifluorobut-3-enoylamino)butanedioic acid

C8H8F3NO5 — CID 131848287

IUPAC(2S)-2-(3,4,4-trifluorobut-3-enoylamino)butanedioic acid
SMILESO=C(O)C[C@H](NC(=O)CC(F)=C(F)F)C(=O)O
InChIInChI=1S/C8H8F3NO5/c9-3(7(10)11)1-5(13)12-4(8(16)17)2-6(14)15/h4H,1-2H2,(H,12,13)(H,14,15)(H,16,17)/t4-/m0/s1
InChIKeyQXNLUDWHYNWQOV-BYPYZUCNSA-N
MW255.15 g/mol
LogP0.50
Rot. Bonds6

About (2S)-2-(3,4,4-trifluorobut-3-enoylamino)butanedioic acid

(2S)-2-(3,4,4-trifluorobut-3-enoylamino)butanedioic acid (PubChem CID 131848287) has the molecular formula C8H8F3NO5 and a molecular weight of 255.15 g/mol. Its IUPAC name is (2S)-2-(3,4,4-trifluorobut-3-enoylamino)butanedioic acid.

Molecular Properties

Compound Name(2S)-2-(3,4,4-trifluorobut-3-enoylamino)butanedioic acid
PubChem CID131848287
Molecular FormulaC8H8F3NO5
Molecular Weight255.15 g/mol
Exact Mass255.04
IUPAC Name(2S)-2-(3,4,4-trifluorobut-3-enoylamino)butanedioic acid
SMILESO=C(O)C[C@H](NC(=O)CC(F)=C(F)F)C(=O)O
InChIInChI=1S/C8H8F3NO5/c9-3(7(10)11)1-5(13)12-4(8(16)17)2-6(14)15/h4H,1-2H2,(H,12,13)(H,14,15)(H,16,17)/t4-/m0/s1
InChIKeyQXNLUDWHYNWQOV-BYPYZUCNSA-N
XLogP0.50
TPSA103.70 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.15
LogP ≤ 50.50
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze (2S)-2-(3,4,4-trifluorobut-3-enoylamino)butanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-(3,4,4-trifluorobut-3-enoylamino)butanedioic acid?
The IUPAC name of (2S)-2-(3,4,4-trifluorobut-3-enoylamino)butanedioic acid (CID 131848287) is (2S)-2-(3,4,4-trifluorobut-3-enoylamino)butanedioic acid.
What is the SMILES notation for (2S)-2-(3,4,4-trifluorobut-3-enoylamino)butanedioic acid?
The canonical SMILES for (2S)-2-(3,4,4-trifluorobut-3-enoylamino)butanedioic acid is O=C(O)C[C@H](NC(=O)CC(F)=C(F)F)C(=O)O.
What is the InChIKey of (2S)-2-(3,4,4-trifluorobut-3-enoylamino)butanedioic acid?
The InChIKey is QXNLUDWHYNWQOV-BYPYZUCNSA-N. The full InChI is InChI=1S/C8H8F3NO5/c9-3(7(10)11)1-5(13)12-4(8(16)17)2-6(14)15/h4H,1-2H2,(H,12,13)(H,14,15)(H,16,17)/t4-/m0/s1.
What are the key properties of (2S)-2-(3,4,4-trifluorobut-3-enoylamino)butanedioic acid?
(2S)-2-(3,4,4-trifluorobut-3-enoylamino)butanedioic acid has a molecular weight of 255.15 g/mol, XLogP of 0.50, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(3,4,4-trifluorobut-3-enoylamino)butanedioic acid is sourced from PubChem (CID 131848287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).