C5H7NO4S2 — CID 3033625
(2S)-2-(dithiocarboxyamino)butanedioic acid (PubChem CID 3033625) has the molecular formula C5H7NO4S2 and a molecular weight of 209.25 g/mol. Its IUPAC name is (2S)-2-(dithiocarboxyamino)butanedioic acid.
| Compound Name | (2S)-2-(dithiocarboxyamino)butanedioic acid |
|---|---|
| PubChem CID | 3033625 |
| Molecular Formula | C5H7NO4S2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 208.98 |
| IUPAC Name | (2S)-2-(dithiocarboxyamino)butanedioic acid |
| SMILES | O=C(O)C[C@H](NC(=S)S)C(=O)O |
| InChI | InChI=1S/C5H7NO4S2/c7-3(8)1-2(4(9)10)6-5(11)12/h2H,1H2,(H,7,8)(H,9,10)(H2,6,11,12)/t2-/m0/s1 |
| InChIKey | CTAOXWJZZKARRP-REOHCLBHSA-N |
| XLogP | -0.28 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|