C14H30N4O3 — CID 156839952
2-amino-3-methyl-N-(2-oxopropyl)but-2-enamide;ethane;propylurea (PubChem CID 156839952) has the molecular formula C14H30N4O3 and a molecular weight of 302.42 g/mol. Its IUPAC name is 2-amino-3-methyl-N-(2-oxopropyl)but-2-enamide;ethane;propylurea.
| Compound Name | 2-amino-3-methyl-N-(2-oxopropyl)but-2-enamide;ethane;propylurea |
|---|---|
| PubChem CID | 156839952 |
| Molecular Formula | C14H30N4O3 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.23 |
| IUPAC Name | 2-amino-3-methyl-N-(2-oxopropyl)but-2-enamide;ethane;propylurea |
| SMILES | CC.CC(=O)CNC(=O)C(N)=C(C)C.CCCNC(N)=O |
| InChI | InChI=1S/C8H14N2O2.C4H10N2O.C2H6/c1-5(2)7(9)8(12)10-4-6(3)11;1-2-3-6-4(5)7;1-2/h4,9H2,1-3H3,(H,10,12);2-3H2,1H3,(H3,5,6,7);1-2H3 |
| InChIKey | ZDGWUDCMRVDZFK-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|