About 2-oxopropylthiourea
2-oxopropylthiourea (PubChem CID 57042056) has the molecular formula C4H8N2OS
and a molecular weight of 132.19 g/mol. Its IUPAC name is 2-oxopropylthiourea.
Molecular Properties
| Compound Name | 2-oxopropylthiourea |
| PubChem CID | 57042056 |
| Molecular Formula | C4H8N2OS |
| Molecular Weight | 132.19 g/mol |
| Exact Mass | 132.04 |
| IUPAC Name | 2-oxopropylthiourea |
| SMILES | CC(=O)CNC(N)=S |
| InChI | InChI=1S/C4H8N2OS/c1-3(7)2-6-4(5)8/h2H2,1H3,(H3,5,6,8) |
| InChIKey | SPMPOEVCXWGPIB-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.19 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-oxopropylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxopropylthiourea?
The IUPAC name of 2-oxopropylthiourea (CID 57042056) is 2-oxopropylthiourea.
What is the SMILES notation for 2-oxopropylthiourea?
The canonical SMILES for 2-oxopropylthiourea is CC(=O)CNC(N)=S.
What is the InChIKey of 2-oxopropylthiourea?
The InChIKey is SPMPOEVCXWGPIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2OS/c1-3(7)2-6-4(5)8/h2H2,1H3,(H3,5,6,8).
What are the key properties of 2-oxopropylthiourea?
2-oxopropylthiourea has a molecular weight of 132.19 g/mol, XLogP of -0.59, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxopropylthiourea is sourced from PubChem (CID 57042056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).