About azane;ethylthiourea
azane;ethylthiourea (PubChem CID 175294002) has the molecular formula C3H11N3S
and a molecular weight of 121.21 g/mol. Its IUPAC name is azane;ethylthiourea.
Molecular Properties
| Compound Name | azane;ethylthiourea |
| PubChem CID | 175294002 |
| Molecular Formula | C3H11N3S |
| Molecular Weight | 121.21 g/mol |
| Exact Mass | 121.07 |
| IUPAC Name | azane;ethylthiourea |
| SMILES | CCNC(N)=S.N |
| InChI | InChI=1S/C3H8N2S.H3N/c1-2-5-3(4)6;/h2H2,1H3,(H3,4,5,6);1H3 |
| InChIKey | RNFFOBQJOUKIFB-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.21 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze azane;ethylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;ethylthiourea?
The IUPAC name of azane;ethylthiourea (CID 175294002) is azane;ethylthiourea.
What is the SMILES notation for azane;ethylthiourea?
The canonical SMILES for azane;ethylthiourea is CCNC(N)=S.N.
What is the InChIKey of azane;ethylthiourea?
The InChIKey is RNFFOBQJOUKIFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8N2S.H3N/c1-2-5-3(4)6;/h2H2,1H3,(H3,4,5,6);1H3.
What are the key properties of azane;ethylthiourea?
azane;ethylthiourea has a molecular weight of 121.21 g/mol, XLogP of 0.00, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;ethylthiourea is sourced from PubChem (CID 175294002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).