C16H32N4O3 — CID 178033953
2-(ethylamino)-3-methyl-N-(3-methyl-2-oxobutyl)but-2-enamide;propylurea (PubChem CID 178033953) has the molecular formula C16H32N4O3 and a molecular weight of 328.46 g/mol. Its IUPAC name is 2-(ethylamino)-3-methyl-N-(3-methyl-2-oxobutyl)but-2-enamide;propylurea.
| Compound Name | 2-(ethylamino)-3-methyl-N-(3-methyl-2-oxobutyl)but-2-enamide;propylurea |
|---|---|
| PubChem CID | 178033953 |
| Molecular Formula | C16H32N4O3 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.25 |
| IUPAC Name | 2-(ethylamino)-3-methyl-N-(3-methyl-2-oxobutyl)but-2-enamide;propylurea |
| SMILES | CCCNC(N)=O.CCNC(C(=O)NCC(=O)C(C)C)=C(C)C |
| InChI | InChI=1S/C12H22N2O2.C4H10N2O/c1-6-13-11(9(4)5)12(16)14-7-10(15)8(2)3;1-2-3-6-4(5)7/h8,13H,6-7H2,1-5H3,(H,14,16);2-3H2,1H3,(H3,5,6,7) |
| InChIKey | YIDTZIAIPBOCOM-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|