About 7-cyclohexyloctan-4-ol
7-cyclohexyloctan-4-ol (PubChem CID 66612590) has the molecular formula C14H28O
and a molecular weight of 212.38 g/mol. Its IUPAC name is 7-cyclohexyloctan-4-ol.
Molecular Properties
| Compound Name | 7-cyclohexyloctan-4-ol |
| PubChem CID | 66612590 |
| Molecular Formula | C14H28O |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.21 |
| IUPAC Name | 7-cyclohexyloctan-4-ol |
| SMILES | CCCC(O)CCC(C)C1CCCCC1 |
| InChI | InChI=1S/C14H28O/c1-3-7-14(15)11-10-12(2)13-8-5-4-6-9-13/h12-15H,3-11H2,1-2H3 |
| InChIKey | TZICSBOVBWHWMN-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-cyclohexyloctan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-cyclohexyloctan-4-ol?
The IUPAC name of 7-cyclohexyloctan-4-ol (CID 66612590) is 7-cyclohexyloctan-4-ol.
What is the SMILES notation for 7-cyclohexyloctan-4-ol?
The canonical SMILES for 7-cyclohexyloctan-4-ol is CCCC(O)CCC(C)C1CCCCC1.
What is the InChIKey of 7-cyclohexyloctan-4-ol?
The InChIKey is TZICSBOVBWHWMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O/c1-3-7-14(15)11-10-12(2)13-8-5-4-6-9-13/h12-15H,3-11H2,1-2H3.
What are the key properties of 7-cyclohexyloctan-4-ol?
7-cyclohexyloctan-4-ol has a molecular weight of 212.38 g/mol, XLogP of 4.14, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-cyclohexyloctan-4-ol is sourced from PubChem (CID 66612590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).