C12H23Cl2PPd — CID 174766996
dichloropalladium;hexa-2,4-dienyl-di(propan-2-yl)phosphane (PubChem CID 174766996) has the molecular formula C12H23Cl2PPd and a molecular weight of 375.62 g/mol. Its IUPAC name is dichloropalladium;hexa-2,4-dienyl-di(propan-2-yl)phosphane.
| Compound Name | dichloropalladium;hexa-2,4-dienyl-di(propan-2-yl)phosphane |
|---|---|
| PubChem CID | 174766996 |
| Molecular Formula | C12H23Cl2PPd |
| Molecular Weight | 375.62 g/mol |
| Exact Mass | 373.99 |
| IUPAC Name | dichloropalladium;hexa-2,4-dienyl-di(propan-2-yl)phosphane |
| SMILES | CC=CC=CCP(C(C)C)C(C)C.Cl[Pd]Cl |
| InChI | InChI=1S/C12H23P.2ClH.Pd/c1-6-7-8-9-10-13(11(2)3)12(4)5;;;/h6-9,11-12H,10H2,1-5H3;2*1H;/q;;;+2/p-2 |
| InChIKey | BBPZGBMHQQDIDE-UHFFFAOYSA-L |
| XLogP | 5.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.62 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|