C14H27Cl2PPd — CID 174766953
ditert-butyl(hexa-2,4-dienyl)phosphane;dichloropalladium (PubChem CID 174766953) has the molecular formula C14H27Cl2PPd and a molecular weight of 403.67 g/mol. Its IUPAC name is ditert-butyl(hexa-2,4-dienyl)phosphane;dichloropalladium.
| Compound Name | ditert-butyl(hexa-2,4-dienyl)phosphane;dichloropalladium |
|---|---|
| PubChem CID | 174766953 |
| Molecular Formula | C14H27Cl2PPd |
| Molecular Weight | 403.67 g/mol |
| Exact Mass | 402.03 |
| IUPAC Name | ditert-butyl(hexa-2,4-dienyl)phosphane;dichloropalladium |
| SMILES | CC=CC=CCP(C(C)(C)C)C(C)(C)C.Cl[Pd]Cl |
| InChI | InChI=1S/C14H27P.2ClH.Pd/c1-8-9-10-11-12-15(13(2,3)4)14(5,6)7;;;/h8-11H,12H2,1-7H3;2*1H;/q;;;+2/p-2 |
| InChIKey | KVKZEPGUCYUALO-UHFFFAOYSA-L |
| XLogP | 6.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.67 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|