C18H31P — CID 141408933
dicyclohexyl(hexa-2,4-dienyl)phosphane (PubChem CID 141408933) has the molecular formula C18H31P and a molecular weight of 278.42 g/mol. Its IUPAC name is dicyclohexyl(hexa-2,4-dienyl)phosphane.
| Compound Name | dicyclohexyl(hexa-2,4-dienyl)phosphane |
|---|---|
| PubChem CID | 141408933 |
| Molecular Formula | C18H31P |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | dicyclohexyl(hexa-2,4-dienyl)phosphane |
| SMILES | CC=CC=CCP(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C18H31P/c1-2-3-4-11-16-19(17-12-7-5-8-13-17)18-14-9-6-10-15-18/h2-4,11,17-18H,5-10,12-16H2,1H3 |
| InChIKey | RJZYJPKTQBPETQ-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|