C18H36NP — CID 134396516
N-(dicyclohexylphosphanylmethyl)-N,2-dimethylpropan-2-amine (PubChem CID 134396516) has the molecular formula C18H36NP and a molecular weight of 297.47 g/mol. Its IUPAC name is N-(dicyclohexylphosphanylmethyl)-N,2-dimethylpropan-2-amine.
| Compound Name | N-(dicyclohexylphosphanylmethyl)-N,2-dimethylpropan-2-amine |
|---|---|
| PubChem CID | 134396516 |
| Molecular Formula | C18H36NP |
| Molecular Weight | 297.47 g/mol |
| Exact Mass | 297.26 |
| IUPAC Name | N-(dicyclohexylphosphanylmethyl)-N,2-dimethylpropan-2-amine |
| SMILES | CN(CP(C1CCCCC1)C1CCCCC1)C(C)(C)C |
| InChI | InChI=1S/C18H36NP/c1-18(2,3)19(4)15-20(16-11-7-5-8-12-16)17-13-9-6-10-14-17/h16-17H,5-15H2,1-4H3 |
| InChIKey | KWRFSRWVHIFKIQ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.47 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|